C16H16F3IO6S — CID 15366976
[phenyl-(2,4,6-trimethoxyphenyl)-lambda3-iodanyl] trifluoromethanesulfonate (PubChem CID 15366976) has the molecular formula C16H16F3IO6S and a molecular weight of 520.26 g/mol. Its IUPAC name is [phenyl-(2,4,6-trimethoxyphenyl)-lambda3-iodanyl] trifluoromethanesulfonate.
| Compound Name | [phenyl-(2,4,6-trimethoxyphenyl)-lambda3-iodanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15366976 |
| Molecular Formula | C16H16F3IO6S |
| Molecular Weight | 520.26 g/mol |
| Exact Mass | 519.97 |
| IUPAC Name | [phenyl-(2,4,6-trimethoxyphenyl)-lambda3-iodanyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OC)c(I(OS(=O)(=O)C(F)(F)F)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H16F3IO6S/c1-23-12-9-13(24-2)15(14(10-12)25-3)20(11-7-5-4-6-8-11)26-27(21,22)16(17,18)19/h4-10H,1-3H3 |
| InChIKey | WOHBEPOVRCIOEN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|