About N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine
N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine (PubChem CID 15367094) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine.
Molecular Properties
| Compound Name | N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine |
| PubChem CID | 15367094 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine |
| SMILES | CC(C)=CCC[C@@H](C)C/C=N/N(C)C |
| InChI | InChI=1S/C12H24N2/c1-11(2)7-6-8-12(3)9-10-13-14(4)5/h7,10,12H,6,8-9H2,1-5H3/b13-10+/t12-/m1/s1 |
| InChIKey | JGGSPBQWKCFAMR-GMCKNXKJSA-N |
| XLogP | 3.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine?
The IUPAC name of N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine (CID 15367094) is N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine.
What is the SMILES notation for N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine?
The canonical SMILES for N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine is CC(C)=CCC[C@@H](C)C/C=N/N(C)C.
What is the InChIKey of N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine?
The InChIKey is JGGSPBQWKCFAMR-GMCKNXKJSA-N. The full InChI is InChI=1S/C12H24N2/c1-11(2)7-6-8-12(3)9-10-13-14(4)5/h7,10,12H,6,8-9H2,1-5H3/b13-10+/t12-/m1/s1.
What are the key properties of N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine?
N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine has a molecular weight of 196.34 g/mol, XLogP of 3.31, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-N-methylmethanamine is sourced from PubChem (CID 15367094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).