About gold(1+);trifluoromethanesulfonate;triphenylphosphane
gold(1+);trifluoromethanesulfonate;triphenylphosphane (PubChem CID 15367309) has the molecular formula C19H15AuF3O3PS
and a molecular weight of 608.33 g/mol. Its IUPAC name is gold(1+);trifluoromethanesulfonate;triphenylphosphane.
Molecular Properties
| Compound Name | gold(1+);trifluoromethanesulfonate;triphenylphosphane |
| PubChem CID | 15367309 |
| Molecular Formula | C19H15AuF3O3PS |
| Molecular Weight | 608.33 g/mol |
| Exact Mass | 608.01 |
| IUPAC Name | gold(1+);trifluoromethanesulfonate;triphenylphosphane |
| SMILES | O=S(=O)([O-])C(F)(F)F.[Au+].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.CHF3O3S.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7;/h1-15H;(H,5,6,7);/q;;+1/p-1 |
| InChIKey | PKNGCXGJNWEWTH-UHFFFAOYSA-M |
| XLogP | 3.49 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 608.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);trifluoromethanesulfonate;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);trifluoromethanesulfonate;triphenylphosphane?
The IUPAC name of gold(1+);trifluoromethanesulfonate;triphenylphosphane (CID 15367309) is gold(1+);trifluoromethanesulfonate;triphenylphosphane.
What is the SMILES notation for gold(1+);trifluoromethanesulfonate;triphenylphosphane?
The canonical SMILES for gold(1+);trifluoromethanesulfonate;triphenylphosphane is O=S(=O)([O-])C(F)(F)F.[Au+].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of gold(1+);trifluoromethanesulfonate;triphenylphosphane?
The InChIKey is PKNGCXGJNWEWTH-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15P.CHF3O3S.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7;/h1-15H;(H,5,6,7);/q;;+1/p-1.
What are the key properties of gold(1+);trifluoromethanesulfonate;triphenylphosphane?
gold(1+);trifluoromethanesulfonate;triphenylphosphane has a molecular weight of 608.33 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);trifluoromethanesulfonate;triphenylphosphane is sourced from PubChem (CID 15367309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).