C36H20EuF9N2O6S3 — CID 15369070
europium(3+);1,10-phenanthroline;tris((Z)-4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbut-1-en-1-olate) (PubChem CID 15369070) has the molecular formula C36H20EuF9N2O6S3 and a molecular weight of 995.71 g/mol. Its IUPAC name is europium(3+);1,10-phenanthroline;tris((Z)-4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbut-1-en-1-olate).
| Compound Name | europium(3+);1,10-phenanthroline;tris((Z)-4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbut-1-en-1-olate) |
|---|---|
| PubChem CID | 15369070 |
| Molecular Formula | C36H20EuF9N2O6S3 |
| Molecular Weight | 995.71 g/mol |
| Exact Mass | 995.96 |
| IUPAC Name | europium(3+);1,10-phenanthroline;tris((Z)-4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbut-1-en-1-olate) |
| SMILES | O=C(/C=C(\[O-])c1cccs1)C(F)(F)F.O=C(/C=C(\[O-])c1cccs1)C(F)(F)F.O=C(/C=C(\[O-])c1cccs1)C(F)(F)F.[Eu+3].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.3C8H5F3O2S.Eu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3*9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h1-8H;3*1-4,12H;/q;;;;+3/p-3/b;3*5-4-; |
| InChIKey | GMFTYFSOONOZOH-MCTJRNESSA-K |
| XLogP | 7.53 |
| TPSA | 146.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.71 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|