C51H51N3O12 — CID 15369232
ethyl 2-[[26,27-bis(2-ethoxy-2-oxoethoxy)-7,15,23-tripyridin-4-yl-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaen-25-yl]oxy]acetate (PubChem CID 15369232) has the molecular formula C51H51N3O12 and a molecular weight of 897.98 g/mol. Its IUPAC name is ethyl 2-[[26,27-bis(2-ethoxy-2-oxoethoxy)-7,15,23-tripyridin-4-yl-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaen-25-yl]oxy]acetate.
| Compound Name | ethyl 2-[[26,27-bis(2-ethoxy-2-oxoethoxy)-7,15,23-tripyridin-4-yl-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaen-25-yl]oxy]acetate |
|---|---|
| PubChem CID | 15369232 |
| Molecular Formula | C51H51N3O12 |
| Molecular Weight | 897.98 g/mol |
| Exact Mass | 897.35 |
| IUPAC Name | ethyl 2-[[26,27-bis(2-ethoxy-2-oxoethoxy)-7,15,23-tripyridin-4-yl-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaen-25-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1c2cc(-c3ccncc3)cc1COCc1cc(-c3ccncc3)cc(c1OCC(=O)OCC)COCc1cc(-c3ccncc3)cc(c1OCC(=O)OCC)COC2 |
| InChI | InChI=1S/C51H51N3O12/c1-4-61-46(55)31-64-49-40-19-37(34-7-13-52-14-8-34)20-41(49)26-59-28-43-22-39(36-11-17-54-18-12-36)24-45(51(43)66-33-48(57)63-6-3)30-60-29-44-23-38(35-9-15-53-16-10-35)21-42(27-58-25-40)50(44)65-32-47(56)62-5-2/h7-24H,4-6,25-33H2,1-3H3 |
| InChIKey | CFNPCSSWTMAAJY-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 172.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.98 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|