About methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate
methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 15369531) has the molecular formula C16H22O5
and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| PubChem CID | 15369531 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | CCCCCCCCOC1=C(C(=O)OC)C(=O)C=CC1=O |
| InChI | InChI=1S/C16H22O5/c1-3-4-5-6-7-8-11-21-15-13(18)10-9-12(17)14(15)16(19)20-2/h9-10H,3-8,11H2,1-2H3 |
| InChIKey | IKNFEOXUWKYWCK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
The IUPAC name of methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (CID 15369531) is methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
What is the SMILES notation for methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
The canonical SMILES for methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate is CCCCCCCCOC1=C(C(=O)OC)C(=O)C=CC1=O.
What is the InChIKey of methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
The InChIKey is IKNFEOXUWKYWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O5/c1-3-4-5-6-7-8-11-21-15-13(18)10-9-12(17)14(15)16(19)20-2/h9-10H,3-8,11H2,1-2H3.
What are the key properties of methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate has a molecular weight of 294.35 g/mol, XLogP of 2.50, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-octoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate is sourced from PubChem (CID 15369531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).