About 3-(4-methoxyphenyl)-1,2,4-oxadiazole
3-(4-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 15369611) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| PubChem CID | 15369611 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2ncon2)cc1 |
| InChI | InChI=1S/C9H8N2O2/c1-12-8-4-2-7(3-5-8)9-10-6-13-11-9/h2-6H,1H3 |
| InChIKey | LRAJKSNHAPTXKV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methoxyphenyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-1,2,4-oxadiazole?
The IUPAC name of 3-(4-methoxyphenyl)-1,2,4-oxadiazole (CID 15369611) is 3-(4-methoxyphenyl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-(4-methoxyphenyl)-1,2,4-oxadiazole?
The canonical SMILES for 3-(4-methoxyphenyl)-1,2,4-oxadiazole is COc1ccc(-c2ncon2)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-1,2,4-oxadiazole?
The InChIKey is LRAJKSNHAPTXKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-12-8-4-2-7(3-5-8)9-10-6-13-11-9/h2-6H,1H3.
What are the key properties of 3-(4-methoxyphenyl)-1,2,4-oxadiazole?
3-(4-methoxyphenyl)-1,2,4-oxadiazole has a molecular weight of 176.17 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-1,2,4-oxadiazole is sourced from PubChem (CID 15369611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).