About 2-fluoro-3-iodopyrazine
2-fluoro-3-iodopyrazine (PubChem CID 15369693) has the molecular formula C4H2FIN2
and a molecular weight of 223.98 g/mol. Its IUPAC name is 2-fluoro-3-iodopyrazine.
Molecular Properties
| Compound Name | 2-fluoro-3-iodopyrazine |
| PubChem CID | 15369693 |
| Molecular Formula | C4H2FIN2 |
| Molecular Weight | 223.98 g/mol |
| Exact Mass | 223.92 |
| IUPAC Name | 2-fluoro-3-iodopyrazine |
| SMILES | Fc1nccnc1I |
| InChI | InChI=1S/C4H2FIN2/c5-3-4(6)8-2-1-7-3/h1-2H |
| InChIKey | ZGDOFCZYQIJHRG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.98 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-iodopyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-iodopyrazine?
The IUPAC name of 2-fluoro-3-iodopyrazine (CID 15369693) is 2-fluoro-3-iodopyrazine.
What is the SMILES notation for 2-fluoro-3-iodopyrazine?
The canonical SMILES for 2-fluoro-3-iodopyrazine is Fc1nccnc1I.
What is the InChIKey of 2-fluoro-3-iodopyrazine?
The InChIKey is ZGDOFCZYQIJHRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2FIN2/c5-3-4(6)8-2-1-7-3/h1-2H.
What are the key properties of 2-fluoro-3-iodopyrazine?
2-fluoro-3-iodopyrazine has a molecular weight of 223.98 g/mol, XLogP of 1.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-iodopyrazine is sourced from PubChem (CID 15369693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).