About 2-bromo-3-fluoropyrazine
2-bromo-3-fluoropyrazine (PubChem CID 15369694) has the molecular formula C4H2BrFN2
and a molecular weight of 176.98 g/mol. Its IUPAC name is 2-bromo-3-fluoropyrazine.
Molecular Properties
| Compound Name | 2-bromo-3-fluoropyrazine |
| PubChem CID | 15369694 |
| Molecular Formula | C4H2BrFN2 |
| Molecular Weight | 176.98 g/mol |
| Exact Mass | 175.94 |
| IUPAC Name | 2-bromo-3-fluoropyrazine |
| SMILES | Fc1nccnc1Br |
| InChI | InChI=1S/C4H2BrFN2/c5-3-4(6)8-2-1-7-3/h1-2H |
| InChIKey | QIDLQERJCKEQOL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.98 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-3-fluoropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-fluoropyrazine?
The IUPAC name of 2-bromo-3-fluoropyrazine (CID 15369694) is 2-bromo-3-fluoropyrazine.
What is the SMILES notation for 2-bromo-3-fluoropyrazine?
The canonical SMILES for 2-bromo-3-fluoropyrazine is Fc1nccnc1Br.
What is the InChIKey of 2-bromo-3-fluoropyrazine?
The InChIKey is QIDLQERJCKEQOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrFN2/c5-3-4(6)8-2-1-7-3/h1-2H.
What are the key properties of 2-bromo-3-fluoropyrazine?
2-bromo-3-fluoropyrazine has a molecular weight of 176.98 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-fluoropyrazine is sourced from PubChem (CID 15369694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).