About 4-ethoxypyrazol-1-amine
4-ethoxypyrazol-1-amine (PubChem CID 15369772) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is 4-ethoxypyrazol-1-amine.
Molecular Properties
| Compound Name | 4-ethoxypyrazol-1-amine |
| PubChem CID | 15369772 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 4-ethoxypyrazol-1-amine |
| SMILES | CCOc1cnn(N)c1 |
| InChI | InChI=1S/C5H9N3O/c1-2-9-5-3-7-8(6)4-5/h3-4H,2,6H2,1H3 |
| InChIKey | VFYKIUDFJIZOER-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethoxypyrazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxypyrazol-1-amine?
The IUPAC name of 4-ethoxypyrazol-1-amine (CID 15369772) is 4-ethoxypyrazol-1-amine.
What is the SMILES notation for 4-ethoxypyrazol-1-amine?
The canonical SMILES for 4-ethoxypyrazol-1-amine is CCOc1cnn(N)c1.
What is the InChIKey of 4-ethoxypyrazol-1-amine?
The InChIKey is VFYKIUDFJIZOER-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-2-9-5-3-7-8(6)4-5/h3-4H,2,6H2,1H3.
What are the key properties of 4-ethoxypyrazol-1-amine?
4-ethoxypyrazol-1-amine has a molecular weight of 127.15 g/mol, XLogP of -0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxypyrazol-1-amine is sourced from PubChem (CID 15369772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).