About 4-methylpentan-2-yl benzenesulfonate
4-methylpentan-2-yl benzenesulfonate (PubChem CID 15369985) has the molecular formula C12H18O3S
and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-methylpentan-2-yl benzenesulfonate.
Molecular Properties
| Compound Name | 4-methylpentan-2-yl benzenesulfonate |
| PubChem CID | 15369985 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 4-methylpentan-2-yl benzenesulfonate |
| SMILES | CC(C)CC(C)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H18O3S/c1-10(2)9-11(3)15-16(13,14)12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | YBEBACLSSPNIIP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentan-2-yl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-yl benzenesulfonate?
The IUPAC name of 4-methylpentan-2-yl benzenesulfonate (CID 15369985) is 4-methylpentan-2-yl benzenesulfonate.
What is the SMILES notation for 4-methylpentan-2-yl benzenesulfonate?
The canonical SMILES for 4-methylpentan-2-yl benzenesulfonate is CC(C)CC(C)OS(=O)(=O)c1ccccc1.
What is the InChIKey of 4-methylpentan-2-yl benzenesulfonate?
The InChIKey is YBEBACLSSPNIIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S/c1-10(2)9-11(3)15-16(13,14)12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3.
What are the key properties of 4-methylpentan-2-yl benzenesulfonate?
4-methylpentan-2-yl benzenesulfonate has a molecular weight of 242.34 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-yl benzenesulfonate is sourced from PubChem (CID 15369985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).