About 2-anilinoacetamide
2-anilinoacetamide (PubChem CID 15370319) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 2-anilinoacetamide.
Molecular Properties
| Compound Name | 2-anilinoacetamide |
| PubChem CID | 15370319 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 2-anilinoacetamide |
| SMILES | NC(=O)CNc1ccccc1 |
| InChI | InChI=1S/C8H10N2O/c9-8(11)6-10-7-4-2-1-3-5-7/h1-5,10H,6H2,(H2,9,11) |
| InChIKey | GXBRYTMUEZNYJT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-anilinoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinoacetamide?
The IUPAC name of 2-anilinoacetamide (CID 15370319) is 2-anilinoacetamide.
What is the SMILES notation for 2-anilinoacetamide?
The canonical SMILES for 2-anilinoacetamide is NC(=O)CNc1ccccc1.
What is the InChIKey of 2-anilinoacetamide?
The InChIKey is GXBRYTMUEZNYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c9-8(11)6-10-7-4-2-1-3-5-7/h1-5,10H,6H2,(H2,9,11).
What are the key properties of 2-anilinoacetamide?
2-anilinoacetamide has a molecular weight of 150.18 g/mol, XLogP of 0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinoacetamide is sourced from PubChem (CID 15370319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).