About diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate
diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate (PubChem CID 15370415) has the molecular formula C16H24N4O4
and a molecular weight of 336.39 g/mol. Its IUPAC name is diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate |
| PubChem CID | 15370415 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C/C=N/n1nnc(C)c1C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H24N4O4/c1-6-9-16(14(21)23-7-2,15(22)24-8-3)10-11-17-20-13(5)12(4)18-19-20/h6,11H,1,7-10H2,2-5H3/b17-11+ |
| InChIKey | UJAPLMLIHSXTLJ-GZTJUZNOSA-N |
| XLogP | 1.81 |
| TPSA | 95.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate?
The IUPAC name of diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate (CID 15370415) is diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate.
What is the SMILES notation for diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate?
The canonical SMILES for diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate is C=CCC(C/C=N/n1nnc(C)c1C)(C(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate?
The InChIKey is UJAPLMLIHSXTLJ-GZTJUZNOSA-N. The full InChI is InChI=1S/C16H24N4O4/c1-6-9-16(14(21)23-7-2,15(22)24-8-3)10-11-17-20-13(5)12(4)18-19-20/h6,11H,1,7-10H2,2-5H3/b17-11+.
What are the key properties of diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate?
diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate has a molecular weight of 336.39 g/mol, XLogP of 1.81, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(2E)-2-(4,5-dimethyltriazol-1-yl)iminoethyl]-2-prop-2-enylpropanedioate is sourced from PubChem (CID 15370415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).