About 4-(3,4-dimethylpentyl)morpholine
4-(3,4-dimethylpentyl)morpholine (PubChem CID 15370628) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 4-(3,4-dimethylpentyl)morpholine.
Molecular Properties
| Compound Name | 4-(3,4-dimethylpentyl)morpholine |
| PubChem CID | 15370628 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 4-(3,4-dimethylpentyl)morpholine |
| SMILES | CC(C)C(C)CCN1CCOCC1 |
| InChI | InChI=1S/C11H23NO/c1-10(2)11(3)4-5-12-6-8-13-9-7-12/h10-11H,4-9H2,1-3H3 |
| InChIKey | HNRBZJXYDQGSGS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-dimethylpentyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylpentyl)morpholine?
The IUPAC name of 4-(3,4-dimethylpentyl)morpholine (CID 15370628) is 4-(3,4-dimethylpentyl)morpholine.
What is the SMILES notation for 4-(3,4-dimethylpentyl)morpholine?
The canonical SMILES for 4-(3,4-dimethylpentyl)morpholine is CC(C)C(C)CCN1CCOCC1.
What is the InChIKey of 4-(3,4-dimethylpentyl)morpholine?
The InChIKey is HNRBZJXYDQGSGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-10(2)11(3)4-5-12-6-8-13-9-7-12/h10-11H,4-9H2,1-3H3.
What are the key properties of 4-(3,4-dimethylpentyl)morpholine?
4-(3,4-dimethylpentyl)morpholine has a molecular weight of 185.31 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylpentyl)morpholine is sourced from PubChem (CID 15370628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).