methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate

C10H14O2 — CID 15370782

IUPACmethyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate
SMILESC=C=C1C(CC(=O)OC)C1(C)C
InChIInChI=1S/C10H14O2/c1-5-7-8(10(7,2)3)6-9(11)12-4/h8H,1,6H2,2-4H3
InChIKeySTITYGDAEGPEDX-UHFFFAOYSA-N
MW166.22 g/mol
LogP1.92
Rot. Bonds2

About methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate

methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate (PubChem CID 15370782) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate.

Molecular Properties

Compound Namemethyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate
PubChem CID15370782
Molecular FormulaC10H14O2
Molecular Weight166.22 g/mol
Exact Mass166.10
IUPAC Namemethyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate
SMILESC=C=C1C(CC(=O)OC)C1(C)C
InChIInChI=1S/C10H14O2/c1-5-7-8(10(7,2)3)6-9(11)12-4/h8H,1,6H2,2-4H3
InChIKeySTITYGDAEGPEDX-UHFFFAOYSA-N
XLogP1.92
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.22
LogP ≤ 51.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate?
The IUPAC name of methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate (CID 15370782) is methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate.
What is the SMILES notation for methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate?
The canonical SMILES for methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate is C=C=C1C(CC(=O)OC)C1(C)C.
What is the InChIKey of methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate?
The InChIKey is STITYGDAEGPEDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-5-7-8(10(7,2)3)6-9(11)12-4/h8H,1,6H2,2-4H3.
What are the key properties of methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate?
methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate has a molecular weight of 166.22 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-ethenylidene-2,2-dimethylcyclopropyl)acetate is sourced from PubChem (CID 15370782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).