About benzyl pyrazole-1-carboxylate
benzyl pyrazole-1-carboxylate (PubChem CID 15371419) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is benzyl pyrazole-1-carboxylate.
Molecular Properties
| Compound Name | benzyl pyrazole-1-carboxylate |
| PubChem CID | 15371419 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | benzyl pyrazole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)n1cccn1 |
| InChI | InChI=1S/C11H10N2O2/c14-11(13-8-4-7-12-13)15-9-10-5-2-1-3-6-10/h1-8H,9H2 |
| InChIKey | VCOVXPNYFAUGFN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl pyrazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl pyrazole-1-carboxylate?
The IUPAC name of benzyl pyrazole-1-carboxylate (CID 15371419) is benzyl pyrazole-1-carboxylate.
What is the SMILES notation for benzyl pyrazole-1-carboxylate?
The canonical SMILES for benzyl pyrazole-1-carboxylate is O=C(OCc1ccccc1)n1cccn1.
What is the InChIKey of benzyl pyrazole-1-carboxylate?
The InChIKey is VCOVXPNYFAUGFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c14-11(13-8-4-7-12-13)15-9-10-5-2-1-3-6-10/h1-8H,9H2.
What are the key properties of benzyl pyrazole-1-carboxylate?
benzyl pyrazole-1-carboxylate has a molecular weight of 202.21 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl pyrazole-1-carboxylate is sourced from PubChem (CID 15371419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).