About trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate
trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate (PubChem CID 15371717) has the molecular formula C15H24O3Si
and a molecular weight of 280.44 g/mol. Its IUPAC name is trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate |
| PubChem CID | 15371717 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C(=O)CC[C@H]1CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C15H24O3Si/c1-15(14(17)18-2)12(9-10-13(15)16)8-6-7-11-19(3,4)5/h12H,6,8-10H2,1-5H3/t12-,15-/m1/s1 |
| InChIKey | LFYRTEWQKMVNEZ-IUODEOHRSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate?
The IUPAC name of trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate (CID 15371717) is trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate.
What is the SMILES notation for trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate?
The canonical SMILES for trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate is COC(=O)[C@@]1(C)C(=O)CC[C@H]1CCC#C[Si](C)(C)C.
What is the InChIKey of trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate?
The InChIKey is LFYRTEWQKMVNEZ-IUODEOHRSA-N. The full InChI is InChI=1S/C15H24O3Si/c1-15(14(17)18-2)12(9-10-13(15)16)8-6-7-11-19(3,4)5/h12H,6,8-10H2,1-5H3/t12-,15-/m1/s1.
What are the key properties of trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate?
trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate has a molecular weight of 280.44 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1R,5R)-1-methyl-2-oxo-5-(4-trimethylsilylbut-3-ynyl)cyclopentane-1-carboxylate is sourced from PubChem (CID 15371717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).