C12H20O2 — CID 15372022
(3aR,4R,6aR)-4-ethyl-4,6,6-trimethyl-3,3a,5,6a-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 15372022) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (3aR,4R,6aR)-4-ethyl-4,6,6-trimethyl-3,3a,5,6a-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,6aR)-4-ethyl-4,6,6-trimethyl-3,3a,5,6a-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 15372022 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3aR,4R,6aR)-4-ethyl-4,6,6-trimethyl-3,3a,5,6a-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | CC[C@]1(C)CC(C)(C)[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C12H20O2/c1-5-12(4)7-11(2,3)10-8(12)6-9(13)14-10/h8,10H,5-7H2,1-4H3/t8-,10+,12+/m0/s1 |
| InChIKey | ICVWOACAXXQULY-MKPLZMMCSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |