C11H21BrOSi — CID 15372031
[(1S,4Z,8S)-8-bromocyclooct-4-en-1-yl]oxy-trimethylsilane (PubChem CID 15372031) has the molecular formula C11H21BrOSi and a molecular weight of 277.28 g/mol. Its IUPAC name is [(1S,4Z,8S)-8-bromocyclooct-4-en-1-yl]oxy-trimethylsilane.
| Compound Name | [(1S,4Z,8S)-8-bromocyclooct-4-en-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15372031 |
| Molecular Formula | C11H21BrOSi |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | [(1S,4Z,8S)-8-bromocyclooct-4-en-1-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[C@H]1CC/C=C\CC[C@@H]1Br |
| InChI | InChI=1S/C11H21BrOSi/c1-14(2,3)13-11-9-7-5-4-6-8-10(11)12/h4-5,10-11H,6-9H2,1-3H3/b5-4-/t10-,11-/m0/s1 |
| InChIKey | RZLKLMXELFRCPK-XXJOZFEBSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|