C6H9NO3 — CID 15372190
3,5-dimethyl-4-oxido-2,3-dihydro-1,4-oxazin-4-ium-6-one (PubChem CID 15372190) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is 3,5-dimethyl-4-oxido-2,3-dihydro-1,4-oxazin-4-ium-6-one.
| Compound Name | 3,5-dimethyl-4-oxido-2,3-dihydro-1,4-oxazin-4-ium-6-one |
|---|---|
| PubChem CID | 15372190 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 3,5-dimethyl-4-oxido-2,3-dihydro-1,4-oxazin-4-ium-6-one |
| SMILES | CC1=[N+]([O-])C(C)COC1=O |
| InChI | InChI=1S/C6H9NO3/c1-4-3-10-6(8)5(2)7(4)9/h4H,3H2,1-2H3 |
| InChIKey | WREIDWVLCUZVNJ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|