C20H33ClO6 — CID 15372475
2-[(2R,4aS,5R,6S,8aS)-5-(carboxymethyl)-2-[(1S)-2-chloro-1-hydroxyethyl]-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid (PubChem CID 15372475) has the molecular formula C20H33ClO6 and a molecular weight of 404.93 g/mol. Its IUPAC name is 2-[(2R,4aS,5R,6S,8aS)-5-(carboxymethyl)-2-[(1S)-2-chloro-1-hydroxyethyl]-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid.
| Compound Name | 2-[(2R,4aS,5R,6S,8aS)-5-(carboxymethyl)-2-[(1S)-2-chloro-1-hydroxyethyl]-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 15372475 |
| Molecular Formula | C20H33ClO6 |
| Molecular Weight | 404.93 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-[(2R,4aS,5R,6S,8aS)-5-(carboxymethyl)-2-[(1S)-2-chloro-1-hydroxyethyl]-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)[C@H]1CC[C@]2(C)O[C@@](C)([C@H](O)CCl)CC[C@H]2[C@]1(C)CC(=O)O |
| InChI | InChI=1S/C20H33ClO6/c1-17(2,16(25)26)12-6-8-19(4)13(18(12,3)10-15(23)24)7-9-20(5,27-19)14(22)11-21/h12-14,22H,6-11H2,1-5H3,(H,23,24)(H,25,26)/t12-,13+,14-,18-,19+,20-/m1/s1 |
| InChIKey | BKRUBSVLDZLXMF-CMKQGYTDSA-N |
| XLogP | 3.53 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.93 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|