C24H16N2O2 — CID 15373756
1-(3-benzoyl-2,8-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaen-5-yl)ethanone (PubChem CID 15373756) has the molecular formula C24H16N2O2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-(3-benzoyl-2,8-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaen-5-yl)ethanone.
| Compound Name | 1-(3-benzoyl-2,8-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaen-5-yl)ethanone |
|---|---|
| PubChem CID | 15373756 |
| Molecular Formula | C24H16N2O2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-(3-benzoyl-2,8-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaen-5-yl)ethanone |
| SMILES | CC(=O)c1cc(C(=O)c2ccccc2)n2c3ccccc3c3cccnc3c12 |
| InChI | InChI=1S/C24H16N2O2/c1-15(27)19-14-21(24(28)16-8-3-2-4-9-16)26-20-12-6-5-10-17(20)18-11-7-13-25-22(18)23(19)26/h2-14H,1H3 |
| InChIKey | AKVLIVUOQYNZDU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|