About tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate
tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate (PubChem CID 15375062) has the molecular formula C29H29NO2
and a molecular weight of 423.56 g/mol. Its IUPAC name is tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate |
| PubChem CID | 15375062 |
| Molecular Formula | C29H29NO2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate |
| SMILES | C=Cc1ccc(/C=C/c2ccc(/C=C/c3ccc(C=C)cc3)n2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H29NO2/c1-6-22-8-12-24(13-9-22)16-18-26-20-21-27(30(26)28(31)32-29(3,4)5)19-17-25-14-10-23(7-2)11-15-25/h6-21H,1-2H2,3-5H3/b18-16+,19-17+ |
| InChIKey | QERSZIJMESWAIU-YWNVXTCZSA-N |
| XLogP | 7.90 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate?
The IUPAC name of tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate (CID 15375062) is tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate.
What is the SMILES notation for tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate?
The canonical SMILES for tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate is C=Cc1ccc(/C=C/c2ccc(/C=C/c3ccc(C=C)cc3)n2C(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate?
The InChIKey is QERSZIJMESWAIU-YWNVXTCZSA-N. The full InChI is InChI=1S/C29H29NO2/c1-6-22-8-12-24(13-9-22)16-18-26-20-21-27(30(26)28(31)32-29(3,4)5)19-17-25-14-10-23(7-2)11-15-25/h6-21H,1-2H2,3-5H3/b18-16+,19-17+.
What are the key properties of tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate?
tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate has a molecular weight of 423.56 g/mol, XLogP of 7.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,5-bis[(E)-2-(4-ethenylphenyl)ethenyl]pyrrole-1-carboxylate is sourced from PubChem (CID 15375062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).