About 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane
6-methyl-2-phenyl-1,3,6,2-dioxazaborocane (PubChem CID 15375366) has the molecular formula C11H16BNO2
and a molecular weight of 205.07 g/mol. Its IUPAC name is 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane.
Molecular Properties
| Compound Name | 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane |
| PubChem CID | 15375366 |
| Molecular Formula | C11H16BNO2 |
| Molecular Weight | 205.07 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane |
| SMILES | CN1CCOB(c2ccccc2)OCC1 |
| InChI | InChI=1S/C11H16BNO2/c1-13-7-9-14-12(15-10-8-13)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3 |
| InChIKey | STYAQQQTUSOBDR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.07 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane?
The IUPAC name of 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane (CID 15375366) is 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane.
What is the SMILES notation for 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane?
The canonical SMILES for 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane is CN1CCOB(c2ccccc2)OCC1.
What is the InChIKey of 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane?
The InChIKey is STYAQQQTUSOBDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BNO2/c1-13-7-9-14-12(15-10-8-13)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3.
What are the key properties of 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane?
6-methyl-2-phenyl-1,3,6,2-dioxazaborocane has a molecular weight of 205.07 g/mol, XLogP of 0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-phenyl-1,3,6,2-dioxazaborocane is sourced from PubChem (CID 15375366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).