C25H10Br6 — CID 15375393
2,2',4,4',7,7'-hexabromo-9,9'-spirobi[fluorene] (PubChem CID 15375393) has the molecular formula C25H10Br6 and a molecular weight of 789.78 g/mol. Its IUPAC name is 2,2',4,4',7,7'-hexabromo-9,9'-spirobi[fluorene].
| Compound Name | 2,2',4,4',7,7'-hexabromo-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 15375393 |
| Molecular Formula | C25H10Br6 |
| Molecular Weight | 789.78 g/mol |
| Exact Mass | 783.59 |
| IUPAC Name | 2,2',4,4',7,7'-hexabromo-9,9'-spirobi[fluorene] |
| SMILES | Brc1ccc2c(c1)C1(c3cc(Br)ccc3-c3c(Br)cc(Br)cc31)c1cc(Br)cc(Br)c1-2 |
| InChI | InChI=1S/C25H10Br6/c26-11-1-3-15-17(5-11)25(19-7-13(28)9-21(30)23(15)19)18-6-12(27)2-4-16(18)24-20(25)8-14(29)10-22(24)31/h1-10H |
| InChIKey | KADZTMJNKSPAOW-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.78 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |