C17H28F2O — CID 15376156
1-(2,2-difluoroethenoxy)-4-(4-propylcyclohexyl)cyclohexane (PubChem CID 15376156) has the molecular formula C17H28F2O and a molecular weight of 286.41 g/mol. Its IUPAC name is 1-(2,2-difluoroethenoxy)-4-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 1-(2,2-difluoroethenoxy)-4-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 15376156 |
| Molecular Formula | C17H28F2O |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 1-(2,2-difluoroethenoxy)-4-(4-propylcyclohexyl)cyclohexane |
| SMILES | CCCC1CCC(C2CCC(OC=C(F)F)CC2)CC1 |
| InChI | InChI=1S/C17H28F2O/c1-2-3-13-4-6-14(7-5-13)15-8-10-16(11-9-15)20-12-17(18)19/h12-16H,2-11H2,1H3 |
| InChIKey | SVCCXNKFPDNMER-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|