About 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide
5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide (PubChem CID 15376487) has the molecular formula C15H24FN3O
and a molecular weight of 281.38 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide |
| PubChem CID | 15376487 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(F)c1C(=O)NC1CCCCC1C(C)C |
| InChI | InChI=1S/C15H24FN3O/c1-9(2)11-7-5-6-8-12(11)17-15(20)13-10(3)18-19(4)14(13)16/h9,11-12H,5-8H2,1-4H3,(H,17,20) |
| InChIKey | UPIFTRPAELPCAP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide?
The IUPAC name of 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide (CID 15376487) is 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide.
What is the SMILES notation for 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide?
The canonical SMILES for 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide is Cc1nn(C)c(F)c1C(=O)NC1CCCCC1C(C)C.
What is the InChIKey of 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide?
The InChIKey is UPIFTRPAELPCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24FN3O/c1-9(2)11-7-5-6-8-12(11)17-15(20)13-10(3)18-19(4)14(13)16/h9,11-12H,5-8H2,1-4H3,(H,17,20).
What are the key properties of 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide?
5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide has a molecular weight of 281.38 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,3-dimethyl-N-(2-propan-2-ylcyclohexyl)pyrazole-4-carboxamide is sourced from PubChem (CID 15376487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).