C20H39N — CID 15376585
2,2,6,6-tetramethyl-1-undec-10-enylpiperidine (PubChem CID 15376585) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-undec-10-enylpiperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-undec-10-enylpiperidine |
|---|---|
| PubChem CID | 15376585 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-undec-10-enylpiperidine |
| SMILES | C=CCCCCCCCCCN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C20H39N/c1-6-7-8-9-10-11-12-13-14-18-21-19(2,3)16-15-17-20(21,4)5/h6H,1,7-18H2,2-5H3 |
| InChIKey | OWMCZCHCUOFQTM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|