About phenylbenzene
phenylbenzene (PubChem CID 15377226) has the molecular formula C12H8-2
and a molecular weight of 152.20 g/mol. Its IUPAC name is phenylbenzene.
Molecular Properties
| Compound Name | phenylbenzene |
| PubChem CID | 15377226 |
| Molecular Formula | C12H8-2 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | phenylbenzene |
| SMILES | [c-]1c[c-]cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H8/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-4,7-10H/q-2 |
| InChIKey | RQXJDDVWCBACFP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylbenzene?
The IUPAC name of phenylbenzene (CID 15377226) is phenylbenzene.
What is the SMILES notation for phenylbenzene?
The canonical SMILES for phenylbenzene is [c-]1c[c-]cc(-c2ccccc2)c1.
What is the InChIKey of phenylbenzene?
The InChIKey is RQXJDDVWCBACFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-4,7-10H/q-2.
What are the key properties of phenylbenzene?
phenylbenzene has a molecular weight of 152.20 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenylbenzene is sourced from PubChem (CID 15377226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).