C32H40N8 — CID 15377250
1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane (PubChem CID 15377250) has the molecular formula C32H40N8 and a molecular weight of 536.73 g/mol. Its IUPAC name is 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 15377250 |
| Molecular Formula | C32H40N8 |
| Molecular Weight | 536.73 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane |
| SMILES | c1ccc(CN2CCN(Cc3ccccn3)CCN(Cc3ccccn3)CCN(Cc3ccccn3)CC2)nc1 |
| InChI | InChI=1S/C32H40N8/c1-5-13-33-29(9-1)25-37-17-19-38(26-30-10-2-6-14-34-30)21-23-40(28-32-12-4-8-16-36-32)24-22-39(20-18-37)27-31-11-3-7-15-35-31/h1-16H,17-28H2 |
| InChIKey | NVFSHTYUVXEYKP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |