2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid

C5H6N2O4 — CID 15377291

IUPAC2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid
SMILESO=C1C=C(C(=O)O)NC(O)N1
InChIInChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1,5-6,11H,(H,7,8)(H,9,10)
InChIKeyOWPPRPKKRGSWIW-UHFFFAOYSA-N
MW158.11 g/mol
LogP-2.05
Rot. Bonds1

About 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid

2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid (PubChem CID 15377291) has the molecular formula C5H6N2O4 and a molecular weight of 158.11 g/mol. Its IUPAC name is 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid
PubChem CID15377291
Molecular FormulaC5H6N2O4
Molecular Weight158.11 g/mol
Exact Mass158.03
IUPAC Name2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid
SMILESO=C1C=C(C(=O)O)NC(O)N1
InChIInChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1,5-6,11H,(H,7,8)(H,9,10)
InChIKeyOWPPRPKKRGSWIW-UHFFFAOYSA-N
XLogP-2.05
TPSA98.66 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.11
LogP ≤ 5-2.05
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid?
The IUPAC name of 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid (CID 15377291) is 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid.
What is the SMILES notation for 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid?
The canonical SMILES for 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid is O=C1C=C(C(=O)O)NC(O)N1.
What is the InChIKey of 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid?
The InChIKey is OWPPRPKKRGSWIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1,5-6,11H,(H,7,8)(H,9,10).
What are the key properties of 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid?
2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid has a molecular weight of 158.11 g/mol, XLogP of -2.05, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-6-oxo-2,3-dihydro-1H-pyrimidine-4-carboxylic acid is sourced from PubChem (CID 15377291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).