C20H30O — CID 15377906
(1S,7S,8Z,11R,12S)-1,4,8-trimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradeca-3,8-dien-5-one (PubChem CID 15377906) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (1S,7S,8Z,11R,12S)-1,4,8-trimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradeca-3,8-dien-5-one.
| Compound Name | (1S,7S,8Z,11R,12S)-1,4,8-trimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradeca-3,8-dien-5-one |
|---|---|
| PubChem CID | 15377906 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (1S,7S,8Z,11R,12S)-1,4,8-trimethyl-12-propan-2-yltricyclo[9.3.0.03,7]tetradeca-3,8-dien-5-one |
| SMILES | CC1=C2C[C@]3(C)CC[C@@H](C(C)C)[C@H]3C/C=C(/C)[C@@H]2CC1=O |
| InChI | InChI=1S/C20H30O/c1-12(2)15-8-9-20(5)11-17-14(4)19(21)10-16(17)13(3)6-7-18(15)20/h6,12,15-16,18H,7-11H2,1-5H3/b13-6-/t15-,16-,18+,20-/m0/s1 |
| InChIKey | INDQHMQHKNSFDS-DYWYNRKGSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|