C13H12N4O2 — CID 15378037
1,3,5,8-tetrazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),9,11,13(17)-tetraene-4,6-dione (PubChem CID 15378037) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 1,3,5,8-tetrazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),9,11,13(17)-tetraene-4,6-dione.
| Compound Name | 1,3,5,8-tetrazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),9,11,13(17)-tetraene-4,6-dione |
|---|---|
| PubChem CID | 15378037 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1,3,5,8-tetrazatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),9,11,13(17)-tetraene-4,6-dione |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)Nc1cccc3c1N2CCC3 |
| InChI | InChI=1S/C13H12N4O2/c18-12-9-11(15-13(19)16-12)17-6-2-4-7-3-1-5-8(14-9)10(7)17/h1,3,5,14H,2,4,6H2,(H2,15,16,18,19) |
| InChIKey | CJQRDSMNBCYCPQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |