C40H56O2 — CID 15378100
3-[(3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-26-(3,3-dimethyloxiran-2-yl)-3,7,11,16,20,24-hexamethylhexacosa-3,5,7,9,11,13,15,17,19,21,23-undecaenyl]-2,2-dimethyloxirane (PubChem CID 15378100) has the molecular formula C40H56O2 and a molecular weight of 568.89 g/mol. Its IUPAC name is 3-[(3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-26-(3,3-dimethyloxiran-2-yl)-3,7,11,16,20,24-hexamethylhexacosa-3,5,7,9,11,13,15,17,19,21,23-undecaenyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-26-(3,3-dimethyloxiran-2-yl)-3,7,11,16,20,24-hexamethylhexacosa-3,5,7,9,11,13,15,17,19,21,23-undecaenyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 15378100 |
| Molecular Formula | C40H56O2 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.43 |
| IUPAC Name | 3-[(3E,5E,7E,9E,11E,13E,15E,17E,19E,21E,23E)-26-(3,3-dimethyloxiran-2-yl)-3,7,11,16,20,24-hexamethylhexacosa-3,5,7,9,11,13,15,17,19,21,23-undecaenyl]-2,2-dimethyloxirane |
| SMILES | CC(/C=C/C=C(C)/C=C/C=C(\C)CCC1OC1(C)C)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C=C(/C)CCC1OC1(C)C |
| InChI | InChI=1S/C40H56O2/c1-31(19-13-21-33(3)23-15-25-35(5)27-29-37-39(7,8)41-37)17-11-12-18-32(2)20-14-22-34(4)24-16-26-36(6)28-30-38-40(9,10)42-38/h11-26,37-38H,27-30H2,1-10H3/b12-11+,19-13+,20-14+,23-15+,24-16+,31-17+,32-18+,33-21+,34-22+,35-25+,36-26+ |
| InChIKey | GMJHZCBAXBEVTL-USJAUHPMSA-N |
| XLogP | 11.36 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|