C14H22O2 — CID 15379502
(1S,2R,5R,7R)-2,6,6-trimethyl-8-oxatricyclo[5.4.1.01,5]dodecan-9-one (PubChem CID 15379502) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1S,2R,5R,7R)-2,6,6-trimethyl-8-oxatricyclo[5.4.1.01,5]dodecan-9-one.
| Compound Name | (1S,2R,5R,7R)-2,6,6-trimethyl-8-oxatricyclo[5.4.1.01,5]dodecan-9-one |
|---|---|
| PubChem CID | 15379502 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1S,2R,5R,7R)-2,6,6-trimethyl-8-oxatricyclo[5.4.1.01,5]dodecan-9-one |
| SMILES | C[C@@H]1CC[C@H]2C(C)(C)[C@H]3C[C@@]12CCC(=O)O3 |
| InChI | InChI=1S/C14H22O2/c1-9-4-5-10-13(2,3)11-8-14(9,10)7-6-12(15)16-11/h9-11H,4-8H2,1-3H3/t9-,10+,11-,14+/m1/s1 |
| InChIKey | ADTWECNQBASKKQ-DEKYYXRVSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |