C11H16O — CID 15379664
(2E,4E,6E)-3,7-dimethylnona-2,4,6,8-tetraen-1-ol (PubChem CID 15379664) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (2E,4E,6E)-3,7-dimethylnona-2,4,6,8-tetraen-1-ol.
| Compound Name | (2E,4E,6E)-3,7-dimethylnona-2,4,6,8-tetraen-1-ol |
|---|---|
| PubChem CID | 15379664 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (2E,4E,6E)-3,7-dimethylnona-2,4,6,8-tetraen-1-ol |
| SMILES | C=C/C(C)=C/C=C/C(C)=C/CO |
| InChI | InChI=1S/C11H16O/c1-4-10(2)6-5-7-11(3)8-9-12/h4-8,12H,1,9H2,2-3H3/b7-5+,10-6+,11-8+ |
| InChIKey | BRKQESNQYILVIV-FUIMHKSZSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|