About 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium
4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium (PubChem CID 15379933) has the molecular formula C22H22NO5+
and a molecular weight of 380.42 g/mol. Its IUPAC name is 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium.
Molecular Properties
| Compound Name | 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium |
| PubChem CID | 15379933 |
| Molecular Formula | C22H22NO5+ |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium |
| SMILES | CCc1c(C)[o+]c(/C=C/c2ccc([N+](=O)[O-])cc2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C22H22NO5/c1-5-17-14(2)28-20(11-8-15-6-9-16(10-7-15)23(24)25)19-13-22(27-4)21(26-3)12-18(17)19/h6-13H,5H2,1-4H3/q+1/b11-8+ |
| InChIKey | BMHUEPVHDTZMAE-DHZHZOJOSA-N |
| XLogP | 5.68 |
| TPSA | 72.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium?
The IUPAC name of 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium (CID 15379933) is 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium.
What is the SMILES notation for 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium?
The canonical SMILES for 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium is CCc1c(C)[o+]c(/C=C/c2ccc([N+](=O)[O-])cc2)c2cc(OC)c(OC)cc12.
What is the InChIKey of 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium?
The InChIKey is BMHUEPVHDTZMAE-DHZHZOJOSA-N. The full InChI is InChI=1S/C22H22NO5/c1-5-17-14(2)28-20(11-8-15-6-9-16(10-7-15)23(24)25)19-13-22(27-4)21(26-3)12-18(17)19/h6-13H,5H2,1-4H3/q+1/b11-8+.
What are the key properties of 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium?
4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium has a molecular weight of 380.42 g/mol, XLogP of 5.68, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6,7-dimethoxy-3-methyl-1-[(E)-2-(4-nitrophenyl)ethenyl]isochromenylium is sourced from PubChem (CID 15379933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).