C20H14ClF3O7 — CID 15379950
7-methyl-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-[1,3]dioxolo[4,5-g]isochromen-6-ium perchlorate (PubChem CID 15379950) has the molecular formula C20H14ClF3O7 and a molecular weight of 458.77 g/mol. Its IUPAC name is 7-methyl-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-[1,3]dioxolo[4,5-g]isochromen-6-ium perchlorate.
| Compound Name | 7-methyl-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-[1,3]dioxolo[4,5-g]isochromen-6-ium perchlorate |
|---|---|
| PubChem CID | 15379950 |
| Molecular Formula | C20H14ClF3O7 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 7-methyl-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-[1,3]dioxolo[4,5-g]isochromen-6-ium perchlorate |
| SMILES | Cc1cc2cc3c(cc2c(/C=C/c2ccc(C(F)(F)F)cc2)[o+]1)OCO3.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C20H14F3O3.ClHO4/c1-12-8-14-9-18-19(25-11-24-18)10-16(14)17(26-12)7-4-13-2-5-15(6-3-13)20(21,22)23;2-1(3,4)5/h2-10H,11H2,1H3;(H,2,3,4,5)/q+1;/p-1/b7-4+; |
| InChIKey | XIDWPMWERJYPDZ-KQGICBIGSA-M |
| XLogP | 1.18 |
| TPSA | 122.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|