C22H25N3O2 — CID 15379974
4-[(E)-2-(7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepin-1-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 15379974) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-[(E)-2-(7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepin-1-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepin-1-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 15379974 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 4-[(E)-2-(7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepin-1-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | COc1cc2c(cc1OC)C(/C=C/c1ccc(N(C)C)cc1)=NN=C(C)C2 |
| InChI | InChI=1S/C22H25N3O2/c1-15-12-17-13-21(26-4)22(27-5)14-19(17)20(24-23-15)11-8-16-6-9-18(10-7-16)25(2)3/h6-11,13-14H,12H2,1-5H3/b11-8+ |
| InChIKey | SPDPZYAZYUGKSI-DHZHZOJOSA-N |
| XLogP | 4.20 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|