C19H21N3O3 — CID 15380337
[(8bS)-4,8b-dimethyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-(4-hydroxyphenyl)carbamate (PubChem CID 15380337) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is [(8bS)-4,8b-dimethyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-(4-hydroxyphenyl)carbamate.
| Compound Name | [(8bS)-4,8b-dimethyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-(4-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 15380337 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [(8bS)-4,8b-dimethyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-(4-hydroxyphenyl)carbamate |
| SMILES | CN1c2ccc(OC(=O)Nc3ccc(O)cc3)cc2[C@]2(C)CCNC12 |
| InChI | InChI=1S/C19H21N3O3/c1-19-9-10-20-17(19)22(2)16-8-7-14(11-15(16)19)25-18(24)21-12-3-5-13(23)6-4-12/h3-8,11,17,20,23H,9-10H2,1-2H3,(H,21,24)/t17?,19-/m0/s1 |
| InChIKey | FWZNVSTZDWAYIK-NNBQYGFHSA-N |
| XLogP | 3.03 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|