About 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate
3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate (PubChem CID 15380464) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate.
Molecular Properties
| Compound Name | 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate |
| PubChem CID | 15380464 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate |
| SMILES | O=C(C(=O)N1CCCCC1C(=O)OCCCc1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O4/c25-20(18-10-2-1-3-11-18)21(26)24-14-5-4-12-19(24)22(27)28-15-7-9-17-8-6-13-23-16-17/h1-3,6,8,10-11,13,16,19H,4-5,7,9,12,14-15H2 |
| InChIKey | QDJFUMQNAWRXOP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate?
The IUPAC name of 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate (CID 15380464) is 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate.
What is the SMILES notation for 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate?
The canonical SMILES for 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate is O=C(C(=O)N1CCCCC1C(=O)OCCCc1cccnc1)c1ccccc1.
What is the InChIKey of 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate?
The InChIKey is QDJFUMQNAWRXOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4/c25-20(18-10-2-1-3-11-18)21(26)24-14-5-4-12-19(24)22(27)28-15-7-9-17-8-6-13-23-16-17/h1-3,6,8,10-11,13,16,19H,4-5,7,9,12,14-15H2.
What are the key properties of 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate?
3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate has a molecular weight of 380.44 g/mol, XLogP of 2.82, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-ylpropyl 1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate is sourced from PubChem (CID 15380464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).