About 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate
3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate (PubChem CID 15380465) has the molecular formula C21H30N2O4
and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate.
Molecular Properties
| Compound Name | 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
| PubChem CID | 15380465 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C21H30N2O4/c1-4-21(2,3)18(24)19(25)23-13-6-5-11-17(23)20(26)27-14-8-10-16-9-7-12-22-15-16/h7,9,12,15,17H,4-6,8,10-11,13-14H2,1-3H3 |
| InChIKey | QWXZXAJVNZLOLY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate?
The IUPAC name of 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate (CID 15380465) is 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate.
What is the SMILES notation for 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate?
The canonical SMILES for 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate is CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)OCCCc1cccnc1.
What is the InChIKey of 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate?
The InChIKey is QWXZXAJVNZLOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2O4/c1-4-21(2,3)18(24)19(25)23-13-6-5-11-17(23)20(26)27-14-8-10-16-9-7-12-22-15-16/h7,9,12,15,17H,4-6,8,10-11,13-14H2,1-3H3.
What are the key properties of 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate?
3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate has a molecular weight of 374.48 g/mol, XLogP of 2.94, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-ylpropyl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate is sourced from PubChem (CID 15380465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).