C32H43NO4 — CID 15380466
1,7-diphenylheptan-4-yl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate (PubChem CID 15380466) has the molecular formula C32H43NO4 and a molecular weight of 505.70 g/mol. Its IUPAC name is 1,7-diphenylheptan-4-yl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate.
| Compound Name | 1,7-diphenylheptan-4-yl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 15380466 |
| Molecular Formula | C32H43NO4 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 1,7-diphenylheptan-4-yl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)OC(CCCc1ccccc1)CCCc1ccccc1 |
| InChI | InChI=1S/C32H43NO4/c1-4-32(2,3)29(34)30(35)33-24-12-11-23-28(33)31(36)37-27(21-13-19-25-15-7-5-8-16-25)22-14-20-26-17-9-6-10-18-26/h5-10,15-18,27-28H,4,11-14,19-24H2,1-3H3 |
| InChIKey | GOPXHESWWYMFCB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|