C30H39NO4 — CID 15380471
1,5-diphenylpentan-3-yl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate (PubChem CID 15380471) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is 1,5-diphenylpentan-3-yl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate.
| Compound Name | 1,5-diphenylpentan-3-yl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 15380471 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 1,5-diphenylpentan-3-yl 1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)OC(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C30H39NO4/c1-4-30(2,3)27(32)28(33)31-22-12-11-17-26(31)29(34)35-25(20-18-23-13-7-5-8-14-23)21-19-24-15-9-6-10-16-24/h5-10,13-16,25-26H,4,11-12,17-22H2,1-3H3 |
| InChIKey | BEBKBVKXUBLHIE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|