C21H35NO4 — CID 15380475
3-cyclohexylpropyl 1-(3,3-dimethyl-2-oxobutanoyl)piperidine-2-carboxylate (PubChem CID 15380475) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is 3-cyclohexylpropyl 1-(3,3-dimethyl-2-oxobutanoyl)piperidine-2-carboxylate.
| Compound Name | 3-cyclohexylpropyl 1-(3,3-dimethyl-2-oxobutanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 15380475 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 3-cyclohexylpropyl 1-(3,3-dimethyl-2-oxobutanoyl)piperidine-2-carboxylate |
| SMILES | CC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)OCCCC1CCCCC1 |
| InChI | InChI=1S/C21H35NO4/c1-21(2,3)18(23)19(24)22-14-8-7-13-17(22)20(25)26-15-9-12-16-10-5-4-6-11-16/h16-17H,4-15H2,1-3H3 |
| InChIKey | YXBURMMYJOWGPB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|