C20H20N2O4S2 — CID 15380813
2-[(3R)-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]-2,3-dihydro-1,5-benzothiazepin-5-yl]acetic acid (PubChem CID 15380813) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[(3R)-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]-2,3-dihydro-1,5-benzothiazepin-5-yl]acetic acid.
| Compound Name | 2-[(3R)-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]-2,3-dihydro-1,5-benzothiazepin-5-yl]acetic acid |
|---|---|
| PubChem CID | 15380813 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[(3R)-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]-2,3-dihydro-1,5-benzothiazepin-5-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)[C@@H](NC(=O)[C@@H](S)Cc2ccccc2)CSc2ccccc21 |
| InChI | InChI=1S/C20H20N2O4S2/c23-18(24)11-22-15-8-4-5-9-17(15)28-12-14(20(22)26)21-19(25)16(27)10-13-6-2-1-3-7-13/h1-9,14,16,27H,10-12H2,(H,21,25)(H,23,24)/t14-,16-/m0/s1 |
| InChIKey | RYZQAFZHSBVEIT-HOCLYGCPSA-N |
| XLogP | 2.24 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|