About (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid
(2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid (PubChem CID 15380898) has the molecular formula C16H16O4
and a molecular weight of 272.30 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid.
Molecular Properties
| Compound Name | (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid |
| PubChem CID | 15380898 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@H](O)C(=O)O |
| InChI | InChI=1S/C16H16O4/c1-20-16(14(17)15(18)19,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14,17H,1H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | RQJWOLFMWKZKCJ-CQSZACIVSA-N |
| XLogP | 2.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid?
The IUPAC name of (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid (CID 15380898) is (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid.
What is the SMILES notation for (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid?
The canonical SMILES for (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid is COC(c1ccccc1)(c1ccccc1)[C@H](O)C(=O)O.
What is the InChIKey of (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid?
The InChIKey is RQJWOLFMWKZKCJ-CQSZACIVSA-N. The full InChI is InChI=1S/C16H16O4/c1-20-16(14(17)15(18)19,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14,17H,1H3,(H,18,19)/t14-/m1/s1.
What are the key properties of (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid?
(2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid has a molecular weight of 272.30 g/mol, XLogP of 2.02, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid is sourced from PubChem (CID 15380898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).