C16H26N6OS2 — CID 15380913
N-[3-(4-aminobutylamino)propyl]-2-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 15380913) has the molecular formula C16H26N6OS2 and a molecular weight of 382.56 g/mol. Its IUPAC name is N-[3-(4-aminobutylamino)propyl]-2-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-(4-aminobutylamino)propyl]-2-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 15380913 |
| Molecular Formula | C16H26N6OS2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[3-(4-aminobutylamino)propyl]-2-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | NCCCCNCCCNC(=O)c1csc(-c2csc(CCN)n2)n1 |
| InChI | InChI=1S/C16H26N6OS2/c17-5-1-2-7-19-8-3-9-20-15(23)12-10-25-16(22-12)13-11-24-14(21-13)4-6-18/h10-11,19H,1-9,17-18H2,(H,20,23) |
| InChIKey | UIHHDALTZVAFSF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|