C15H22 — CID 15381873
(3R,4aS,8aS)-8a-methyl-5-methylidene-3-prop-1-en-2-yl-1,2,3,4,4a,6-hexahydronaphthalene (PubChem CID 15381873) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is (3R,4aS,8aS)-8a-methyl-5-methylidene-3-prop-1-en-2-yl-1,2,3,4,4a,6-hexahydronaphthalene.
| Compound Name | (3R,4aS,8aS)-8a-methyl-5-methylidene-3-prop-1-en-2-yl-1,2,3,4,4a,6-hexahydronaphthalene |
|---|---|
| PubChem CID | 15381873 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (3R,4aS,8aS)-8a-methyl-5-methylidene-3-prop-1-en-2-yl-1,2,3,4,4a,6-hexahydronaphthalene |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)C=CCC(=C)[C@@H]2C1 |
| InChI | InChI=1S/C15H22/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h5,8,13-14H,1,3,6-7,9-10H2,2,4H3/t13-,14+,15-/m1/s1 |
| InChIKey | VPGIVOTXWKFIRP-QLFBSQMISA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|