C15H20O3 — CID 15381916
(4aR,5S,8R,8aR)-8-hydroxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydrobenzo[f][1]benzofuran-4-one (PubChem CID 15381916) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (4aR,5S,8R,8aR)-8-hydroxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydrobenzo[f][1]benzofuran-4-one.
| Compound Name | (4aR,5S,8R,8aR)-8-hydroxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydrobenzo[f][1]benzofuran-4-one |
|---|---|
| PubChem CID | 15381916 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (4aR,5S,8R,8aR)-8-hydroxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydrobenzo[f][1]benzofuran-4-one |
| SMILES | Cc1coc2c1C(=O)[C@]1(C)[C@@H](C)CC[C@@H](O)[C@@H]1C2 |
| InChI | InChI=1S/C15H20O3/c1-8-7-18-12-6-10-11(16)5-4-9(2)15(10,3)14(17)13(8)12/h7,9-11,16H,4-6H2,1-3H3/t9-,10-,11+,15+/m0/s1 |
| InChIKey | AWXFUOOEZGQLHT-KIGUWFBYSA-N |
| XLogP | 2.74 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |